C15H20F2N2O2S — CID 71994057
N-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-2-methylsulfanylacetamide (PubChem CID 71994057) has the molecular formula C15H20F2N2O2S and a molecular weight of 330.40 g/mol. Its IUPAC name is N-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-2-methylsulfanylacetamide.
| Compound Name | N-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 71994057 |
| Molecular Formula | C15H20F2N2O2S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)NC1CCCN(c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C15H20F2N2O2S/c1-22-10-14(20)18-11-3-2-8-19(9-11)12-4-6-13(7-5-12)21-15(16)17/h4-7,11,15H,2-3,8-10H2,1H3,(H,18,20) |
| InChIKey | OHHISFYPWIZJJW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|