C22H24F3N5O — CID 111998119
1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-2-methylguanidine (PubChem CID 111998119) has the molecular formula C22H24F3N5O and a molecular weight of 431.46 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-2-methylguanidine.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 111998119 |
| Molecular Formula | C22H24F3N5O |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cc(C#N)ccc1F)NC1CCCN(c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C22H24F3N5O/c1-27-22(28-13-16-11-15(12-26)4-9-20(16)23)29-17-3-2-10-30(14-17)18-5-7-19(8-6-18)31-21(24)25/h4-9,11,17,21H,2-3,10,13-14H2,1H3,(H2,27,28,29) |
| InChIKey | HKASKFGRGFPIPO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|