C20H25F2N3O2 — CID 133354772
N-[1-[6-(difluoromethoxy)-2-methylquinolin-4-yl]piperidin-3-yl]butanamide (PubChem CID 133354772) has the molecular formula C20H25F2N3O2 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[1-[6-(difluoromethoxy)-2-methylquinolin-4-yl]piperidin-3-yl]butanamide.
| Compound Name | N-[1-[6-(difluoromethoxy)-2-methylquinolin-4-yl]piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 133354772 |
| Molecular Formula | C20H25F2N3O2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[1-[6-(difluoromethoxy)-2-methylquinolin-4-yl]piperidin-3-yl]butanamide |
| SMILES | CCCC(=O)NC1CCCN(c2cc(C)nc3ccc(OC(F)F)cc23)C1 |
| InChI | InChI=1S/C20H25F2N3O2/c1-3-5-19(26)24-14-6-4-9-25(12-14)18-10-13(2)23-17-8-7-15(11-16(17)18)27-20(21)22/h7-8,10-11,14,20H,3-6,9,12H2,1-2H3,(H,24,26) |
| InChIKey | UFIADRZYQAOSFS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |