C19H21Cl3N4O2 — CID 133354814
N-[1-[2-chloro-4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]piperidin-3-yl]butanamide (PubChem CID 133354814) has the molecular formula C19H21Cl3N4O2 and a molecular weight of 443.76 g/mol. Its IUPAC name is N-[1-[2-chloro-4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]piperidin-3-yl]butanamide.
| Compound Name | N-[1-[2-chloro-4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 133354814 |
| Molecular Formula | C19H21Cl3N4O2 |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | N-[1-[2-chloro-4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]piperidin-3-yl]butanamide |
| SMILES | CCCC(=O)NC1CCCN(c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2Cl)C1 |
| InChI | InChI=1S/C19H21Cl3N4O2/c1-2-4-17(27)24-12-5-3-8-25(11-12)16-7-6-13(9-14(16)20)26-19(28)18(22)15(21)10-23-26/h6-7,9-10,12H,2-5,8,11H2,1H3,(H,24,27) |
| InChIKey | BKAHQLSCDCJABW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|