C17H18Cl3N3O2 — CID 47983009
4,5-dichloro-2-[3-chloro-4-(3-ethoxypiperidin-1-yl)phenyl]pyridazin-3-one (PubChem CID 47983009) has the molecular formula C17H18Cl3N3O2 and a molecular weight of 402.71 g/mol. Its IUPAC name is 4,5-dichloro-2-[3-chloro-4-(3-ethoxypiperidin-1-yl)phenyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[3-chloro-4-(3-ethoxypiperidin-1-yl)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 47983009 |
| Molecular Formula | C17H18Cl3N3O2 |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 4,5-dichloro-2-[3-chloro-4-(3-ethoxypiperidin-1-yl)phenyl]pyridazin-3-one |
| SMILES | CCOC1CCCN(c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2Cl)C1 |
| InChI | InChI=1S/C17H18Cl3N3O2/c1-2-25-12-4-3-7-22(10-12)15-6-5-11(8-13(15)18)23-17(24)16(20)14(19)9-21-23/h5-6,8-9,12H,2-4,7,10H2,1H3 |
| InChIKey | JVXLDBYVNDRTMV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|