C20H23Cl3N4O — CID 133317815
4,5-dichloro-2-[3-chloro-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]phenyl]pyridazin-3-one (PubChem CID 133317815) has the molecular formula C20H23Cl3N4O and a molecular weight of 441.79 g/mol. Its IUPAC name is 4,5-dichloro-2-[3-chloro-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]phenyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[3-chloro-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 133317815 |
| Molecular Formula | C20H23Cl3N4O |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 4,5-dichloro-2-[3-chloro-4-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]phenyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccc(N2CCC(CN3CCCC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H23Cl3N4O/c21-16-11-15(27-20(28)19(23)17(22)12-24-27)3-4-18(16)26-9-5-14(6-10-26)13-25-7-1-2-8-25/h3-4,11-12,14H,1-2,5-10,13H2 |
| InChIKey | KKMWIWHBHMZEPJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|