C18H17Cl3N4O — CID 133453709
2-[4-(4-but-3-ynylpiperazin-1-yl)-3-chlorophenyl]-4,5-dichloropyridazin-3-one (PubChem CID 133453709) has the molecular formula C18H17Cl3N4O and a molecular weight of 411.72 g/mol. Its IUPAC name is 2-[4-(4-but-3-ynylpiperazin-1-yl)-3-chlorophenyl]-4,5-dichloropyridazin-3-one.
| Compound Name | 2-[4-(4-but-3-ynylpiperazin-1-yl)-3-chlorophenyl]-4,5-dichloropyridazin-3-one |
|---|---|
| PubChem CID | 133453709 |
| Molecular Formula | C18H17Cl3N4O |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-[4-(4-but-3-ynylpiperazin-1-yl)-3-chlorophenyl]-4,5-dichloropyridazin-3-one |
| SMILES | C#CCCN1CCN(c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2Cl)CC1 |
| InChI | InChI=1S/C18H17Cl3N4O/c1-2-3-6-23-7-9-24(10-8-23)16-5-4-13(11-14(16)19)25-18(26)17(21)15(20)12-22-25/h1,4-5,11-12H,3,6-10H2 |
| InChIKey | YPAJMJPKLOYJQC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|