C15H14Cl3N3O2 — CID 126806694
4,5-dichloro-2-[3-chloro-4-(3-hydroxy-3-methylpyrrolidin-1-yl)phenyl]pyridazin-3-one (PubChem CID 126806694) has the molecular formula C15H14Cl3N3O2 and a molecular weight of 374.66 g/mol. Its IUPAC name is 4,5-dichloro-2-[3-chloro-4-(3-hydroxy-3-methylpyrrolidin-1-yl)phenyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[3-chloro-4-(3-hydroxy-3-methylpyrrolidin-1-yl)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126806694 |
| Molecular Formula | C15H14Cl3N3O2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 4,5-dichloro-2-[3-chloro-4-(3-hydroxy-3-methylpyrrolidin-1-yl)phenyl]pyridazin-3-one |
| SMILES | CC1(O)CCN(c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2Cl)C1 |
| InChI | InChI=1S/C15H14Cl3N3O2/c1-15(23)4-5-20(8-15)12-3-2-9(6-10(12)16)21-14(22)13(18)11(17)7-19-21/h2-3,6-7,23H,4-5,8H2,1H3 |
| InChIKey | JLGQTHDNJIGJMY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|