C18H19Cl3N4O2 — CID 133274900
N-[[1-[2-chloro-4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]piperidin-3-yl]methyl]acetamide (PubChem CID 133274900) has the molecular formula C18H19Cl3N4O2 and a molecular weight of 429.74 g/mol. Its IUPAC name is N-[[1-[2-chloro-4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]piperidin-3-yl]methyl]acetamide.
| Compound Name | N-[[1-[2-chloro-4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 133274900 |
| Molecular Formula | C18H19Cl3N4O2 |
| Molecular Weight | 429.74 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[[1-[2-chloro-4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]piperidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCCN(c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2Cl)C1 |
| InChI | InChI=1S/C18H19Cl3N4O2/c1-11(26)22-8-12-3-2-6-24(10-12)16-5-4-13(7-14(16)19)25-18(27)17(21)15(20)9-23-25/h4-5,7,9,12H,2-3,6,8,10H2,1H3,(H,22,26) |
| InChIKey | VBIHZRGMHUVKLD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|