C20H16Cl3N3O2 — CID 95345237
4,5-dichloro-2-[3-chloro-4-[(2R)-2-phenylmorpholin-4-yl]phenyl]pyridazin-3-one (PubChem CID 95345237) has the molecular formula C20H16Cl3N3O2 and a molecular weight of 436.73 g/mol. Its IUPAC name is 4,5-dichloro-2-[3-chloro-4-[(2R)-2-phenylmorpholin-4-yl]phenyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[3-chloro-4-[(2R)-2-phenylmorpholin-4-yl]phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 95345237 |
| Molecular Formula | C20H16Cl3N3O2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 4,5-dichloro-2-[3-chloro-4-[(2R)-2-phenylmorpholin-4-yl]phenyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccc(N2CCO[C@H](c3ccccc3)C2)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl3N3O2/c21-15-10-14(26-20(27)19(23)16(22)11-24-26)6-7-17(15)25-8-9-28-18(12-25)13-4-2-1-3-5-13/h1-7,10-11,18H,8-9,12H2/t18-/m0/s1 |
| InChIKey | QJKGMEVFTUFXCG-SFHVURJKSA-N |
| XLogP | 4.77 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|