C18H16ClN3O3 — CID 133347329
4-chloro-5-[2-(furan-2-yl)morpholin-4-yl]-2-phenylpyridazin-3-one (PubChem CID 133347329) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 4-chloro-5-[2-(furan-2-yl)morpholin-4-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(furan-2-yl)morpholin-4-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 133347329 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-chloro-5-[2-(furan-2-yl)morpholin-4-yl]-2-phenylpyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCOC(c3ccco3)C2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C18H16ClN3O3/c19-17-14(11-20-22(18(17)23)13-5-2-1-3-6-13)21-8-10-25-16(12-21)15-7-4-9-24-15/h1-7,9,11,16H,8,10,12H2 |
| InChIKey | PJJTWEMOABNNJU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |