C16H15ClFN3O3 — CID 133330434
4-(3-chloro-5-nitro-2-pyridinyl)-2-(4-fluorophenyl)-6-methylmorpholine (PubChem CID 133330434) has the molecular formula C16H15ClFN3O3 and a molecular weight of 351.77 g/mol. Its IUPAC name is 4-(3-chloro-5-nitro-2-pyridinyl)-2-(4-fluorophenyl)-6-methylmorpholine.
| Compound Name | 4-(3-chloro-5-nitro-2-pyridinyl)-2-(4-fluorophenyl)-6-methylmorpholine |
|---|---|
| PubChem CID | 133330434 |
| Molecular Formula | C16H15ClFN3O3 |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-(3-chloro-5-nitro-2-pyridinyl)-2-(4-fluorophenyl)-6-methylmorpholine |
| SMILES | CC1CN(c2ncc([N+](=O)[O-])cc2Cl)CC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C16H15ClFN3O3/c1-10-8-20(16-14(17)6-13(7-19-16)21(22)23)9-15(24-10)11-2-4-12(18)5-3-11/h2-7,10,15H,8-9H2,1H3 |
| InChIKey | FOYDSCYWDUSAER-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|