C13H20BrN3O3 — CID 133331956
4-bromo-5-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-2-methylpyridazin-3-one (PubChem CID 133331956) has the molecular formula C13H20BrN3O3 and a molecular weight of 346.23 g/mol. Its IUPAC name is 4-bromo-5-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-2-methylpyridazin-3-one.
| Compound Name | 4-bromo-5-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133331956 |
| Molecular Formula | C13H20BrN3O3 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-bromo-5-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]-2-methylpyridazin-3-one |
| SMILES | COCCOCC1CCN(c2cnn(C)c(=O)c2Br)C1 |
| InChI | InChI=1S/C13H20BrN3O3/c1-16-13(18)12(14)11(7-15-16)17-4-3-10(8-17)9-20-6-5-19-2/h7,10H,3-6,8-9H2,1-2H3 |
| InChIKey | KSKWUZFEWOTOOF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|