C13H21BrN4O2 — CID 114445372
5-(3-amino-4-methylpiperidin-1-yl)-4-bromo-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 114445372) has the molecular formula C13H21BrN4O2 and a molecular weight of 345.24 g/mol. Its IUPAC name is 5-(3-amino-4-methylpiperidin-1-yl)-4-bromo-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 5-(3-amino-4-methylpiperidin-1-yl)-4-bromo-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114445372 |
| Molecular Formula | C13H21BrN4O2 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5-(3-amino-4-methylpiperidin-1-yl)-4-bromo-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | COCCn1ncc(N2CCC(C)C(N)C2)c(Br)c1=O |
| InChI | InChI=1S/C13H21BrN4O2/c1-9-3-4-17(8-10(9)15)11-7-16-18(5-6-20-2)13(19)12(11)14/h7,9-10H,3-6,8,15H2,1-2H3 |
| InChIKey | IOFUGFVLZXEMMG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |