C13H21BrN4O3 — CID 114446617
4-bromo-2-(2-methoxyethyl)-5-[2-(methylaminomethyl)morpholin-4-yl]pyridazin-3-one (PubChem CID 114446617) has the molecular formula C13H21BrN4O3 and a molecular weight of 361.24 g/mol. Its IUPAC name is 4-bromo-2-(2-methoxyethyl)-5-[2-(methylaminomethyl)morpholin-4-yl]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-methoxyethyl)-5-[2-(methylaminomethyl)morpholin-4-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 114446617 |
| Molecular Formula | C13H21BrN4O3 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-bromo-2-(2-methoxyethyl)-5-[2-(methylaminomethyl)morpholin-4-yl]pyridazin-3-one |
| SMILES | CNCC1CN(c2cnn(CCOC)c(=O)c2Br)CCO1 |
| InChI | InChI=1S/C13H21BrN4O3/c1-15-7-10-9-17(3-6-21-10)11-8-16-18(4-5-20-2)13(19)12(11)14/h8,10,15H,3-7,9H2,1-2H3 |
| InChIKey | YFEFUHXOYXHCPL-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |