C20H23F2NO3S — CID 133332193
2-(difluoromethylsulfonyl)-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]aniline (PubChem CID 133332193) has the molecular formula C20H23F2NO3S and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]aniline.
| Compound Name | 2-(difluoromethylsulfonyl)-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]aniline |
|---|---|
| PubChem CID | 133332193 |
| Molecular Formula | C20H23F2NO3S |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]aniline |
| SMILES | Cc1ccc(C2OCCCC2CNc2ccccc2S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C20H23F2NO3S/c1-14-8-10-15(11-9-14)19-16(5-4-12-26-19)13-23-17-6-2-3-7-18(17)27(24,25)20(21)22/h2-3,6-11,16,19-20,23H,4-5,12-13H2,1H3 |
| InChIKey | GNJGXAYUBWCKCF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |