C16H13Cl2N5O2 — CID 133333989
[4-[[[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]amino]methyl]phenyl]urea (PubChem CID 133333989) has the molecular formula C16H13Cl2N5O2 and a molecular weight of 378.22 g/mol. Its IUPAC name is [4-[[[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]amino]methyl]phenyl]urea.
| Compound Name | [4-[[[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]amino]methyl]phenyl]urea |
|---|---|
| PubChem CID | 133333989 |
| Molecular Formula | C16H13Cl2N5O2 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [4-[[[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]amino]methyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(CNc2nc(-c3cc(Cl)cc(Cl)c3)no2)cc1 |
| InChI | InChI=1S/C16H13Cl2N5O2/c17-11-5-10(6-12(18)7-11)14-22-16(25-23-14)20-8-9-1-3-13(4-2-9)21-15(19)24/h1-7H,8H2,(H3,19,21,24)(H,20,22,23) |
| InChIKey | BMZNQMNJWQTMAT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |