C16H19N3S — CID 133335140
3-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 133335140) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 3-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133335140 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | c1ccc2c(c1)CCCC2CNc1nc(C2CC2)ns1 |
| InChI | InChI=1S/C16H19N3S/c1-2-7-14-11(4-1)5-3-6-13(14)10-17-16-18-15(19-20-16)12-8-9-12/h1-2,4,7,12-13H,3,5-6,8-10H2,(H,17,18,19) |
| InChIKey | HAIRSZYJFZACEU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |