C12H15N5OS — CID 133335711
6-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyrazine-2-carboxamide (PubChem CID 133335711) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is 6-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyrazine-2-carboxamide.
| Compound Name | 6-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133335711 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 6-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pyrazine-2-carboxamide |
| SMILES | CCc1cnc(C(C)Nc2cncc(C(N)=O)n2)s1 |
| InChI | InChI=1S/C12H15N5OS/c1-3-8-4-15-12(19-8)7(2)16-10-6-14-5-9(17-10)11(13)18/h4-7H,3H2,1-2H3,(H2,13,18)(H,16,17) |
| InChIKey | ROFPYLSZMGCACJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |