C14H22N4O — CID 133335978
4-methyl-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]pyrimidine (PubChem CID 133335978) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-methyl-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-methyl-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133335978 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-methyl-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]pyrimidine |
| SMILES | Cc1cc(N2CCN(CC3CCOC3)CC2)ncn1 |
| InChI | InChI=1S/C14H22N4O/c1-12-8-14(16-11-15-12)18-5-3-17(4-6-18)9-13-2-7-19-10-13/h8,11,13H,2-7,9-10H2,1H3 |
| InChIKey | CHDYLPDJBDBUAZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |