C18H22BrN3O — CID 133336011
7-bromo-4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]quinoline (PubChem CID 133336011) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is 7-bromo-4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]quinoline.
| Compound Name | 7-bromo-4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 133336011 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 7-bromo-4-[4-(oxolan-3-ylmethyl)piperazin-1-yl]quinoline |
| SMILES | Brc1ccc2c(N3CCN(CC4CCOC4)CC3)ccnc2c1 |
| InChI | InChI=1S/C18H22BrN3O/c19-15-1-2-16-17(11-15)20-5-3-18(16)22-8-6-21(7-9-22)12-14-4-10-23-13-14/h1-3,5,11,14H,4,6-10,12-13H2 |
| InChIKey | PEZCJMTVWCMKIN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |