C23H27N3O3 — CID 133337541
[2-[4-(3,5-dimethoxyanilino)piperidin-1-yl]quinolin-3-yl]methanol (PubChem CID 133337541) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is [2-[4-(3,5-dimethoxyanilino)piperidin-1-yl]quinolin-3-yl]methanol.
| Compound Name | [2-[4-(3,5-dimethoxyanilino)piperidin-1-yl]quinolin-3-yl]methanol |
|---|---|
| PubChem CID | 133337541 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [2-[4-(3,5-dimethoxyanilino)piperidin-1-yl]quinolin-3-yl]methanol |
| SMILES | COc1cc(NC2CCN(c3nc4ccccc4cc3CO)CC2)cc(OC)c1 |
| InChI | InChI=1S/C23H27N3O3/c1-28-20-12-19(13-21(14-20)29-2)24-18-7-9-26(10-8-18)23-17(15-27)11-16-5-3-4-6-22(16)25-23/h3-6,11-14,18,24,27H,7-10,15H2,1-2H3 |
| InChIKey | PZMKFVJMGKTVPC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |