C14H13ClN6O3 — CID 133338488
3-[(4-amino-5-nitropyrimidin-2-yl)amino]-1-(3-chlorophenyl)pyrrolidin-2-one (PubChem CID 133338488) has the molecular formula C14H13ClN6O3 and a molecular weight of 348.75 g/mol. Its IUPAC name is 3-[(4-amino-5-nitropyrimidin-2-yl)amino]-1-(3-chlorophenyl)pyrrolidin-2-one.
| Compound Name | 3-[(4-amino-5-nitropyrimidin-2-yl)amino]-1-(3-chlorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 133338488 |
| Molecular Formula | C14H13ClN6O3 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-[(4-amino-5-nitropyrimidin-2-yl)amino]-1-(3-chlorophenyl)pyrrolidin-2-one |
| SMILES | Nc1nc(NC2CCN(c3cccc(Cl)c3)C2=O)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13ClN6O3/c15-8-2-1-3-9(6-8)20-5-4-10(13(20)22)18-14-17-7-11(21(23)24)12(16)19-14/h1-3,6-7,10H,4-5H2,(H3,16,17,18,19) |
| InChIKey | HUEIXGKBFCASSK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|