C14H14ClN3O3S — CID 133339689
N-[4-chloro-3-(methylsulfinylmethyl)phenyl]-4-methyl-5-nitropyridin-2-amine (PubChem CID 133339689) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is N-[4-chloro-3-(methylsulfinylmethyl)phenyl]-4-methyl-5-nitropyridin-2-amine.
| Compound Name | N-[4-chloro-3-(methylsulfinylmethyl)phenyl]-4-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133339689 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-[4-chloro-3-(methylsulfinylmethyl)phenyl]-4-methyl-5-nitropyridin-2-amine |
| SMILES | Cc1cc(Nc2ccc(Cl)c(CS(C)=O)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14ClN3O3S/c1-9-5-14(16-7-13(9)18(19)20)17-11-3-4-12(15)10(6-11)8-22(2)21/h3-7H,8H2,1-2H3,(H,16,17) |
| InChIKey | BAVGNCOCYOQESM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|