C16H19N7 — CID 133341877
5-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-1-phenyltetrazole (PubChem CID 133341877) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is 5-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-1-phenyltetrazole.
| Compound Name | 5-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-1-phenyltetrazole |
|---|---|
| PubChem CID | 133341877 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 5-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]-1-phenyltetrazole |
| SMILES | Cn1cc(CC2CCN(c3nnnn3-c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C16H19N7/c1-21-11-14(10-17-21)9-13-7-8-22(12-13)16-18-19-20-23(16)15-5-3-2-4-6-15/h2-6,10-11,13H,7-9,12H2,1H3 |
| InChIKey | PWSXJWUGEOCCBK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |