C19H18ClN5 — CID 133341908
6-chloro-2-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]quinoline-4-carbonitrile (PubChem CID 133341908) has the molecular formula C19H18ClN5 and a molecular weight of 351.84 g/mol. Its IUPAC name is 6-chloro-2-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]quinoline-4-carbonitrile.
| Compound Name | 6-chloro-2-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133341908 |
| Molecular Formula | C19H18ClN5 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-chloro-2-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]quinoline-4-carbonitrile |
| SMILES | Cn1cc(CC2CCN(c3cc(C#N)c4cc(Cl)ccc4n3)C2)cn1 |
| InChI | InChI=1S/C19H18ClN5/c1-24-11-14(10-22-24)6-13-4-5-25(12-13)19-7-15(9-21)17-8-16(20)2-3-18(17)23-19/h2-3,7-8,10-11,13H,4-6,12H2,1H3 |
| InChIKey | LGLXRQPSQHVSCL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |