C17H15ClN6 — CID 133455579
6-chloro-2-[4-(triazol-1-yl)piperidin-1-yl]quinoline-4-carbonitrile (PubChem CID 133455579) has the molecular formula C17H15ClN6 and a molecular weight of 338.80 g/mol. Its IUPAC name is 6-chloro-2-[4-(triazol-1-yl)piperidin-1-yl]quinoline-4-carbonitrile.
| Compound Name | 6-chloro-2-[4-(triazol-1-yl)piperidin-1-yl]quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133455579 |
| Molecular Formula | C17H15ClN6 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 6-chloro-2-[4-(triazol-1-yl)piperidin-1-yl]quinoline-4-carbonitrile |
| SMILES | N#Cc1cc(N2CCC(n3ccnn3)CC2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H15ClN6/c18-13-1-2-16-15(10-13)12(11-19)9-17(21-16)23-6-3-14(4-7-23)24-8-5-20-22-24/h1-2,5,8-10,14H,3-4,6-7H2 |
| InChIKey | YUSSSLDMBIWWAP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |