C16H22ClN5 — CID 133341990
4-chloro-5-ethyl-2-methyl-6-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]pyrimidine (PubChem CID 133341990) has the molecular formula C16H22ClN5 and a molecular weight of 319.84 g/mol. Its IUPAC name is 4-chloro-5-ethyl-2-methyl-6-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]pyrimidine.
| Compound Name | 4-chloro-5-ethyl-2-methyl-6-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133341990 |
| Molecular Formula | C16H22ClN5 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 4-chloro-5-ethyl-2-methyl-6-[3-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]pyrimidine |
| SMILES | CCc1c(Cl)nc(C)nc1N1CCC(Cc2cnn(C)c2)C1 |
| InChI | InChI=1S/C16H22ClN5/c1-4-14-15(17)19-11(2)20-16(14)22-6-5-12(10-22)7-13-8-18-21(3)9-13/h8-9,12H,4-7,10H2,1-3H3 |
| InChIKey | XVRSGJMWGDHXIS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |