C19H25N5 — CID 133345327
N-[(1R)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-tert-butylpyrimidin-4-amine (PubChem CID 133345327) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-tert-butylpyrimidin-4-amine.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-tert-butylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133345327 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)-2-methylpropyl]-2-tert-butylpyrimidin-4-amine |
| SMILES | CC(C)[C@@H](Nc1ccnc(C(C)(C)C)n1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H25N5/c1-12(2)16(17-21-13-8-6-7-9-14(13)22-17)23-15-10-11-20-18(24-15)19(3,4)5/h6-12,16H,1-5H3,(H,21,22)(H,20,23,24)/t16-/m1/s1 |
| InChIKey | YUBHXGKBJDKGAX-MRXNPFEDSA-N |
| XLogP | 4.46 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |