About 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile
4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile (PubChem CID 133345499) has the molecular formula C16H14F3N3O
and a molecular weight of 321.30 g/mol. Its IUPAC name is 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile |
| PubChem CID | 133345499 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile |
| SMILES | Cc1cc(C)c(CNc2ccc(C#N)cc2C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C16H14F3N3O/c1-9-5-10(2)22-15(23)12(9)8-21-14-4-3-11(7-20)6-13(14)16(17,18)19/h3-6,21H,8H2,1-2H3,(H,22,23) |
| InChIKey | QTUVDUAPMORVKH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile?
The IUPAC name of 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile (CID 133345499) is 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile?
The canonical SMILES for 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile is Cc1cc(C)c(CNc2ccc(C#N)cc2C(F)(F)F)c(=O)[nH]1.
What is the InChIKey of 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile?
The InChIKey is QTUVDUAPMORVKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3N3O/c1-9-5-10(2)22-15(23)12(9)8-21-14-4-3-11(7-20)6-13(14)16(17,18)19/h3-6,21H,8H2,1-2H3,(H,22,23).
What are the key properties of 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile?
4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile has a molecular weight of 321.30 g/mol, XLogP of 3.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylamino]-3-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 133345499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).