C19H17F2N3O4S — CID 133347198
N-(3,4-difluorophenyl)-6-[2-(furan-2-yl)morpholin-4-yl]pyridine-3-sulfonamide (PubChem CID 133347198) has the molecular formula C19H17F2N3O4S and a molecular weight of 421.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-[2-(furan-2-yl)morpholin-4-yl]pyridine-3-sulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-6-[2-(furan-2-yl)morpholin-4-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133347198 |
| Molecular Formula | C19H17F2N3O4S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-[2-(furan-2-yl)morpholin-4-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1)c1ccc(N2CCOC(c3ccco3)C2)nc1 |
| InChI | InChI=1S/C19H17F2N3O4S/c20-15-5-3-13(10-16(15)21)23-29(25,26)14-4-6-19(22-11-14)24-7-9-28-18(12-24)17-2-1-8-27-17/h1-6,8,10-11,18,23H,7,9,12H2 |
| InChIKey | BYYNGLHZKVYJAW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |