C17H17FN2O6 — CID 133347272
ethyl 3-fluoro-2-[2-(furan-2-yl)morpholin-4-yl]-5-nitrobenzoate (PubChem CID 133347272) has the molecular formula C17H17FN2O6 and a molecular weight of 364.33 g/mol. Its IUPAC name is ethyl 3-fluoro-2-[2-(furan-2-yl)morpholin-4-yl]-5-nitrobenzoate.
| Compound Name | ethyl 3-fluoro-2-[2-(furan-2-yl)morpholin-4-yl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 133347272 |
| Molecular Formula | C17H17FN2O6 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | ethyl 3-fluoro-2-[2-(furan-2-yl)morpholin-4-yl]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])cc(F)c1N1CCOC(c2ccco2)C1 |
| InChI | InChI=1S/C17H17FN2O6/c1-2-24-17(21)12-8-11(20(22)23)9-13(18)16(12)19-5-7-26-15(10-19)14-4-3-6-25-14/h3-4,6,8-9,15H,2,5,7,10H2,1H3 |
| InChIKey | MCWCWDQBOCNHRD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|