C19H20N4O2 — CID 133347945
2-[3-(4,6-dimethoxy-1H-indol-2-yl)propylamino]pyridine-3-carbonitrile (PubChem CID 133347945) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propylamino]pyridine-3-carbonitrile.
| Compound Name | 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133347945 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-[3-(4,6-dimethoxy-1H-indol-2-yl)propylamino]pyridine-3-carbonitrile |
| SMILES | COc1cc(OC)c2cc(CCCNc3ncccc3C#N)[nH]c2c1 |
| InChI | InChI=1S/C19H20N4O2/c1-24-15-10-17-16(18(11-15)25-2)9-14(23-17)6-4-8-22-19-13(12-20)5-3-7-21-19/h3,5,7,9-11,23H,4,6,8H2,1-2H3,(H,21,22) |
| InChIKey | RWWZSCIPHDCNNO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|