C20H23N5O4 — CID 133347972
4-[3-(4,6-dimethoxy-1H-indol-2-yl)propylamino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 133347972) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-[3-(4,6-dimethoxy-1H-indol-2-yl)propylamino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
| Compound Name | 4-[3-(4,6-dimethoxy-1H-indol-2-yl)propylamino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 133347972 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-[3-(4,6-dimethoxy-1H-indol-2-yl)propylamino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | COc1cc(OC)c2cc(CCCNc3c(C#N)c(=O)n(C)c(=O)n3C)[nH]c2c1 |
| InChI | InChI=1S/C20H23N5O4/c1-24-18(15(11-21)19(26)25(2)20(24)27)22-7-5-6-12-8-14-16(23-12)9-13(28-3)10-17(14)29-4/h8-10,22-23H,5-7H2,1-4H3 |
| InChIKey | VETYEUGZHGOCRA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|