C15H16ClN3OS2 — CID 133348833
4-chloro-5-(1,4-dithian-2-ylmethylamino)-2-phenylpyridazin-3-one (PubChem CID 133348833) has the molecular formula C15H16ClN3OS2 and a molecular weight of 353.90 g/mol. Its IUPAC name is 4-chloro-5-(1,4-dithian-2-ylmethylamino)-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-(1,4-dithian-2-ylmethylamino)-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 133348833 |
| Molecular Formula | C15H16ClN3OS2 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 4-chloro-5-(1,4-dithian-2-ylmethylamino)-2-phenylpyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCC2CSCCS2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C15H16ClN3OS2/c16-14-13(17-8-12-10-21-6-7-22-12)9-18-19(15(14)20)11-4-2-1-3-5-11/h1-5,9,12,17H,6-8,10H2 |
| InChIKey | MOOWBUAEVVUCIW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |