C14H14ClN3O3 — CID 15152626
ethyl 2-[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]acetate (PubChem CID 15152626) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]acetate.
| Compound Name | ethyl 2-[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 15152626 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | ethyl 2-[(5-chloro-6-oxo-1-phenylpyridazin-4-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1cnn(-c2ccccc2)c(=O)c1Cl |
| InChI | InChI=1S/C14H14ClN3O3/c1-2-21-12(19)9-16-11-8-17-18(14(20)13(11)15)10-6-4-3-5-7-10/h3-8,16H,2,9H2,1H3 |
| InChIKey | MSQGWDURMBIXQH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |