C18H15ClFN3O — CID 18291225
4-chloro-5-[(3-fluoro-4-methylphenyl)methylamino]-2-phenylpyridazin-3-one (PubChem CID 18291225) has the molecular formula C18H15ClFN3O and a molecular weight of 343.79 g/mol. Its IUPAC name is 4-chloro-5-[(3-fluoro-4-methylphenyl)methylamino]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(3-fluoro-4-methylphenyl)methylamino]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 18291225 |
| Molecular Formula | C18H15ClFN3O |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-chloro-5-[(3-fluoro-4-methylphenyl)methylamino]-2-phenylpyridazin-3-one |
| SMILES | Cc1ccc(CNc2cnn(-c3ccccc3)c(=O)c2Cl)cc1F |
| InChI | InChI=1S/C18H15ClFN3O/c1-12-7-8-13(9-15(12)20)10-21-16-11-22-23(18(24)17(16)19)14-5-3-2-4-6-14/h2-9,11,21H,10H2,1H3 |
| InChIKey | ZEXYFDHYUOHISY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |