C22H16ClFN4O2 — CID 133274440
4-chloro-5-[(3-fluoro-4-pyridin-3-yloxyphenyl)methylamino]-2-phenylpyridazin-3-one (PubChem CID 133274440) has the molecular formula C22H16ClFN4O2 and a molecular weight of 422.85 g/mol. Its IUPAC name is 4-chloro-5-[(3-fluoro-4-pyridin-3-yloxyphenyl)methylamino]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(3-fluoro-4-pyridin-3-yloxyphenyl)methylamino]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 133274440 |
| Molecular Formula | C22H16ClFN4O2 |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 4-chloro-5-[(3-fluoro-4-pyridin-3-yloxyphenyl)methylamino]-2-phenylpyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCc2ccc(Oc3cccnc3)c(F)c2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H16ClFN4O2/c23-21-19(14-27-28(22(21)29)16-5-2-1-3-6-16)26-12-15-8-9-20(18(24)11-15)30-17-7-4-10-25-13-17/h1-11,13-14,26H,12H2 |
| InChIKey | HUDPQEZPCKCTJA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |