C20H17FN6O — CID 133274465
N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-1-(4-methylphenyl)tetrazol-5-amine (PubChem CID 133274465) has the molecular formula C20H17FN6O and a molecular weight of 376.40 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-1-(4-methylphenyl)tetrazol-5-amine.
| Compound Name | N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-1-(4-methylphenyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 133274465 |
| Molecular Formula | C20H17FN6O |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-1-(4-methylphenyl)tetrazol-5-amine |
| SMILES | Cc1ccc(-n2nnnc2NCc2ccc(Oc3cccnc3)c(F)c2)cc1 |
| InChI | InChI=1S/C20H17FN6O/c1-14-4-7-16(8-5-14)27-20(24-25-26-27)23-12-15-6-9-19(18(21)11-15)28-17-3-2-10-22-13-17/h2-11,13H,12H2,1H3,(H,23,24,26) |
| InChIKey | ZVCWSYLCJXTFNV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |