C14H16ClN3O2 — CID 133434585
4-chloro-5-[[(2S)-1-hydroxybutan-2-yl]amino]-2-phenylpyridazin-3-one (PubChem CID 133434585) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is 4-chloro-5-[[(2S)-1-hydroxybutan-2-yl]amino]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[[(2S)-1-hydroxybutan-2-yl]amino]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 133434585 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-chloro-5-[[(2S)-1-hydroxybutan-2-yl]amino]-2-phenylpyridazin-3-one |
| SMILES | CC[C@@H](CO)Nc1cnn(-c2ccccc2)c(=O)c1Cl |
| InChI | InChI=1S/C14H16ClN3O2/c1-2-10(9-19)17-12-8-16-18(14(20)13(12)15)11-6-4-3-5-7-11/h3-8,10,17,19H,2,9H2,1H3/t10-/m0/s1 |
| InChIKey | QAXYQUJOSXQGNK-JTQLQIEISA-N |
| XLogP | 2.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |