C21H25N3O4 — CID 133350750
[4-(3-ethoxy-4-nitrophenyl)-1,4-diazepan-1-yl]-(3-methylphenyl)methanone (PubChem CID 133350750) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [4-(3-ethoxy-4-nitrophenyl)-1,4-diazepan-1-yl]-(3-methylphenyl)methanone.
| Compound Name | [4-(3-ethoxy-4-nitrophenyl)-1,4-diazepan-1-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 133350750 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [4-(3-ethoxy-4-nitrophenyl)-1,4-diazepan-1-yl]-(3-methylphenyl)methanone |
| SMILES | CCOc1cc(N2CCCN(C(=O)c3cccc(C)c3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25N3O4/c1-3-28-20-15-18(8-9-19(20)24(26)27)22-10-5-11-23(13-12-22)21(25)17-7-4-6-16(2)14-17/h4,6-9,14-15H,3,5,10-13H2,1-2H3 |
| InChIKey | SKQJSZKJKJHGQH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|