C17H24BrN3O3 — CID 133352828
N-[[1-(2-bromo-4-nitrophenyl)piperidin-3-yl]methyl]-2,2-dimethylpropanamide (PubChem CID 133352828) has the molecular formula C17H24BrN3O3 and a molecular weight of 398.30 g/mol. Its IUPAC name is N-[[1-(2-bromo-4-nitrophenyl)piperidin-3-yl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[1-(2-bromo-4-nitrophenyl)piperidin-3-yl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 133352828 |
| Molecular Formula | C17H24BrN3O3 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-[[1-(2-bromo-4-nitrophenyl)piperidin-3-yl]methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCC1CCCN(c2ccc([N+](=O)[O-])cc2Br)C1 |
| InChI | InChI=1S/C17H24BrN3O3/c1-17(2,3)16(22)19-10-12-5-4-8-20(11-12)15-7-6-13(21(23)24)9-14(15)18/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H,19,22) |
| InChIKey | HISSMLHAJIVWOO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|