2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride

C10H10Cl4GeO — CID 13335376

IUPAC2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride
SMILESCC(C(=O)Cl)C(c1ccccc1)[Ge](Cl)(Cl)Cl
InChIInChI=1S/C10H10Cl4GeO/c1-7(10(11)16)9(15(12,13)14)8-5-3-2-4-6-8/h2-7,9H,1H3
InChIKeyADDDCDBBASHFFI-UHFFFAOYSA-N
MW360.61 g/mol
LogP4.37
Rot. Bonds4

About 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride

2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride (PubChem CID 13335376) has the molecular formula C10H10Cl4GeO and a molecular weight of 360.61 g/mol. Its IUPAC name is 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride.

Molecular Properties

Compound Name2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride
PubChem CID13335376
Molecular FormulaC10H10Cl4GeO
Molecular Weight360.61 g/mol
Exact Mass359.87
IUPAC Name2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride
SMILESCC(C(=O)Cl)C(c1ccccc1)[Ge](Cl)(Cl)Cl
InChIInChI=1S/C10H10Cl4GeO/c1-7(10(11)16)9(15(12,13)14)8-5-3-2-4-6-8/h2-7,9H,1H3
InChIKeyADDDCDBBASHFFI-UHFFFAOYSA-N
XLogP4.37
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.61
LogP ≤ 54.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-chloro-3-methyl-1-phenylbutan-2-one
CID 79006597
3-oxo-2-phenylbutanoyl chloride
CID 141413709
2-methylpropanoyl chloride;toluene
CID 174958428
2-methyl-3-phenylbutanoic acid
CID 29759
(2S)-2-methyl-4-oxo-4-phenyl-3-sulfanylbutanoyl chloride
CID 154417690
2-hydrazinyl-2-phenylacetyl chloride
CID 55280591
acetic acid;cumene
CID 172767405
(2-chloro-2-oxo-1-phenylethyl)azanium chloride
CID 53420366
(3S,4S)-3-methyl-4-phenylpentan-2-one
CID 13413211
(3R,4R)-3-methyl-4-phenylpentan-2-one
CID 13413213
(2S)-2-[[(1R)-2-chloro-2-oxo-1-phenylethyl]amino]-2-phenylacetyl chloride
CID 124679301
1-chloro-1-phenylpropan-2-one;ethane
CID 143290485

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride?
The IUPAC name of 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride (CID 13335376) is 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride.
What is the SMILES notation for 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride?
The canonical SMILES for 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride is CC(C(=O)Cl)C(c1ccccc1)[Ge](Cl)(Cl)Cl.
What is the InChIKey of 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride?
The InChIKey is ADDDCDBBASHFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl4GeO/c1-7(10(11)16)9(15(12,13)14)8-5-3-2-4-6-8/h2-7,9H,1H3.
What are the key properties of 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride?
2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride has a molecular weight of 360.61 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-phenyl-3-trichlorogermylpropanoyl chloride is sourced from PubChem (CID 13335376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).