C20H24FN5O — CID 133353797
1-[(3-fluorophenyl)methyl]-4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-2-one (PubChem CID 133353797) has the molecular formula C20H24FN5O and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 133353797 |
| Molecular Formula | C20H24FN5O |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-4-(6-piperidin-1-ylpyrimidin-4-yl)piperazin-2-one |
| SMILES | O=C1CN(c2cc(N3CCCCC3)ncn2)CCN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H24FN5O/c21-17-6-4-5-16(11-17)13-26-10-9-25(14-20(26)27)19-12-18(22-15-23-19)24-7-2-1-3-8-24/h4-6,11-12,15H,1-3,7-10,13-14H2 |
| InChIKey | YMGHPHPAQOQBSO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |