C17H17FN4O3 — CID 122137910
1-[(3-fluorophenyl)methyl]-4-(6-methyl-5-nitro-2-pyridinyl)piperazin-2-one (PubChem CID 122137910) has the molecular formula C17H17FN4O3 and a molecular weight of 344.35 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-4-(6-methyl-5-nitro-2-pyridinyl)piperazin-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-4-(6-methyl-5-nitro-2-pyridinyl)piperazin-2-one |
|---|---|
| PubChem CID | 122137910 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-4-(6-methyl-5-nitro-2-pyridinyl)piperazin-2-one |
| SMILES | Cc1nc(N2CCN(Cc3cccc(F)c3)C(=O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17FN4O3/c1-12-15(22(24)25)5-6-16(19-12)20-7-8-21(17(23)11-20)10-13-3-2-4-14(18)9-13/h2-6,9H,7-8,10-11H2,1H3 |
| InChIKey | XGTIFHGQRGHYAW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|