C14H18N4S2 — CID 133354561
7-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine (PubChem CID 133354561) has the molecular formula C14H18N4S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is 7-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine.
| Compound Name | 7-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 133354561 |
| Molecular Formula | C14H18N4S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 7-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine |
| SMILES | CSc1nc2ncnc(N3CCC4CCCCC43)c2s1 |
| InChI | InChI=1S/C14H18N4S2/c1-19-14-17-12-11(20-14)13(16-8-15-12)18-7-6-9-4-2-3-5-10(9)18/h8-10H,2-7H2,1H3 |
| InChIKey | HEENDVFLKKGXMB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |