C15H24N4 — CID 82753042
6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-ethyl-N-methylpyrimidin-4-amine (PubChem CID 82753042) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82753042 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1c(NC)ncnc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C15H24N4/c1-3-12-14(16-2)17-10-18-15(12)19-9-8-11-6-4-5-7-13(11)19/h10-11,13H,3-9H2,1-2H3,(H,16,17,18) |
| InChIKey | RLFANTITOZPXNC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |