C12H20N4O — CID 80780914
5-ethyl-N-methyl-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine (PubChem CID 80780914) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 5-ethyl-N-methyl-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine.
| Compound Name | 5-ethyl-N-methyl-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80780914 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 5-ethyl-N-methyl-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine |
| SMILES | CCc1c(NC)ncnc1N1CCOCC1C |
| InChI | InChI=1S/C12H20N4O/c1-4-10-11(13-3)14-8-15-12(10)16-5-6-17-7-9(16)2/h8-9H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | KHWYQULOTQHOIX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |