C15H16N4O3S — CID 133355478
methyl 2-[3-[(4-methylpyrimidin-2-yl)amino]-2-oxopyrrolidin-1-yl]thiophene-3-carboxylate (PubChem CID 133355478) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is methyl 2-[3-[(4-methylpyrimidin-2-yl)amino]-2-oxopyrrolidin-1-yl]thiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[(4-methylpyrimidin-2-yl)amino]-2-oxopyrrolidin-1-yl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 133355478 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl 2-[3-[(4-methylpyrimidin-2-yl)amino]-2-oxopyrrolidin-1-yl]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1N1CCC(Nc2nccc(C)n2)C1=O |
| InChI | InChI=1S/C15H16N4O3S/c1-9-3-6-16-15(17-9)18-11-4-7-19(12(11)20)13-10(5-8-23-13)14(21)22-2/h3,5-6,8,11H,4,7H2,1-2H3,(H,16,17,18) |
| InChIKey | QOYOWUJBIDMOLP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |