C14H20N2O3S — CID 133355858
2-[1-(2-methylsulfonylphenyl)piperidin-3-yl]acetamide (PubChem CID 133355858) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-[1-(2-methylsulfonylphenyl)piperidin-3-yl]acetamide.
| Compound Name | 2-[1-(2-methylsulfonylphenyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 133355858 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[1-(2-methylsulfonylphenyl)piperidin-3-yl]acetamide |
| SMILES | CS(=O)(=O)c1ccccc1N1CCCC(CC(N)=O)C1 |
| InChI | InChI=1S/C14H20N2O3S/c1-20(18,19)13-7-3-2-6-12(13)16-8-4-5-11(10-16)9-14(15)17/h2-3,6-7,11H,4-5,8-10H2,1H3,(H2,15,17) |
| InChIKey | VERLKBMXCRYLDY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |